C27H23N5OS — CID 18451144
1-[4-[4-amino-7-(3-aminophenyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea (PubChem CID 18451144) has the molecular formula C27H23N5OS and a molecular weight of 465.58 g/mol. Its IUPAC name is 1-[4-[4-amino-7-(3-aminophenyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-[4-amino-7-(3-aminophenyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 18451144 |
| Molecular Formula | C27H23N5OS |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 1-[4-[4-amino-7-(3-aminophenyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3csc4c(-c5cccc(N)c5)cnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C27H23N5OS/c1-16-4-2-7-21(12-16)32-27(33)31-20-10-8-17(9-11-20)23-15-34-25-22(14-30-26(29)24(23)25)18-5-3-6-19(28)13-18/h2-15H,28H2,1H3,(H2,29,30)(H2,31,32,33) |
| InChIKey | YQPPRBGITNYZHI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|