C26H24N4O3S — CID 45139882
ethyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate (PubChem CID 45139882) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is ethyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 45139882 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | ethyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(N)c2c(-c3ccc(NC(=O)Nc4cccc(C)c4)cc3)csc12 |
| InChI | InChI=1S/C26H24N4O3S/c1-3-33-22(31)12-9-18-14-28-25(27)23-21(15-34-24(18)23)17-7-10-19(11-8-17)29-26(32)30-20-6-4-5-16(2)13-20/h4-15H,3H2,1-2H3,(H2,27,28)(H2,29,30,32)/b12-9+ |
| InChIKey | VYZISRSSJPMOGU-FMIVXFBMSA-N |
| XLogP | 6.07 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|