C30H24N4O2S — CID 18451214
1-[4-[4-amino-7-(3-phenoxyprop-1-ynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea (PubChem CID 18451214) has the molecular formula C30H24N4O2S and a molecular weight of 504.62 g/mol. Its IUPAC name is 1-[4-[4-amino-7-(3-phenoxyprop-1-ynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-[4-amino-7-(3-phenoxyprop-1-ynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 18451214 |
| Molecular Formula | C30H24N4O2S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-[4-[4-amino-7-(3-phenoxyprop-1-ynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3csc4c(C#CCOc5ccccc5)cnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C30H24N4O2S/c1-20-7-5-9-24(17-20)34-30(35)33-23-14-12-21(13-15-23)26-19-37-28-22(18-32-29(31)27(26)28)8-6-16-36-25-10-3-2-4-11-25/h2-5,7,9-15,17-19H,16H2,1H3,(H2,31,32)(H2,33,34,35) |
| InChIKey | JKXNTJQXJDPLMJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|