C24H17F3N4OS — CID 174495174
1-[4-(4-amino-7-prop-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 174495174) has the molecular formula C24H17F3N4OS and a molecular weight of 466.49 g/mol. Its IUPAC name is 1-[4-(4-amino-7-prop-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(4-amino-7-prop-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 174495174 |
| Molecular Formula | C24H17F3N4OS |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 1-[4-(4-amino-7-prop-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC#Cc1cnc(N)c2c(-c3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)cc3)csc12 |
| InChI | InChI=1S/C24H17F3N4OS/c1-2-4-15-12-29-22(28)20-19(13-33-21(15)20)14-7-9-17(10-8-14)30-23(32)31-18-6-3-5-16(11-18)24(25,26)27/h3,5-13H,1H3,(H2,28,29)(H2,30,31,32) |
| InChIKey | GLSBULYJSMJQDL-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|