C25H19F4N5O4S2 — CID 174495283
[3-[4-amino-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-ynylamino]methyl hydrogen sulfite (PubChem CID 174495283) has the molecular formula C25H19F4N5O4S2 and a molecular weight of 593.58 g/mol. Its IUPAC name is [3-[4-amino-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-ynylamino]methyl hydrogen sulfite.
| Compound Name | [3-[4-amino-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-ynylamino]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 174495283 |
| Molecular Formula | C25H19F4N5O4S2 |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | [3-[4-amino-3-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-ynylamino]methyl hydrogen sulfite |
| SMILES | Nc1ncc(C#CCNCOS(=O)O)c2scc(-c3ccc(NC(=O)Nc4cc(C(F)(F)F)ccc4F)cc3)c12 |
| InChI | InChI=1S/C25H19F4N5O4S2/c26-19-8-5-16(25(27,28)29)10-20(19)34-24(35)33-17-6-3-14(4-7-17)18-12-39-22-15(11-32-23(30)21(18)22)2-1-9-31-13-38-40(36)37/h3-8,10-12,31H,9,13H2,(H2,30,32)(H,36,37)(H2,33,34,35) |
| InChIKey | OIJYZWSVGLRFIV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|