C27H22F3N5OS — CID 18451108
1-[4-[4-amino-7-(2-pyrrolidin-2-ylethynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 18451108) has the molecular formula C27H22F3N5OS and a molecular weight of 521.57 g/mol. Its IUPAC name is 1-[4-[4-amino-7-(2-pyrrolidin-2-ylethynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-amino-7-(2-pyrrolidin-2-ylethynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 18451108 |
| Molecular Formula | C27H22F3N5OS |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-[4-[4-amino-7-(2-pyrrolidin-2-ylethynyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Nc1ncc(C#CC2CCCN2)c2scc(-c3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)cc3)c12 |
| InChI | InChI=1S/C27H22F3N5OS/c28-27(29,30)18-3-1-4-21(13-18)35-26(36)34-20-10-6-16(7-11-20)22-15-37-24-17(14-33-25(31)23(22)24)8-9-19-5-2-12-32-19/h1,3-4,6-7,10-11,13-15,19,32H,2,5,12H2,(H2,31,33)(H2,34,35,36) |
| InChIKey | FFDSLEVDUUSWRV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|