C26H18F3N5OS — CID 18451082
1-[4-[4-amino-7-(2,6-difluoro-3-pyridinyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea (PubChem CID 18451082) has the molecular formula C26H18F3N5OS and a molecular weight of 505.53 g/mol. Its IUPAC name is 1-[4-[4-amino-7-(2,6-difluoro-3-pyridinyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea.
| Compound Name | 1-[4-[4-amino-7-(2,6-difluoro-3-pyridinyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 18451082 |
| Molecular Formula | C26H18F3N5OS |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 1-[4-[4-amino-7-(2,6-difluoro-3-pyridinyl)thieno[3,2-c]pyridin-3-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3csc4c(-c5ccc(F)nc5F)cnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C26H18F3N5OS/c1-13-2-8-19(27)20(10-13)33-26(35)32-15-5-3-14(4-6-15)18-12-36-23-17(11-31-25(30)22(18)23)16-7-9-21(28)34-24(16)29/h2-12H,1H3,(H2,30,31)(H2,32,33,35) |
| InChIKey | YQSUGWIMUMJJRN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|