C19H18BFN4O3 — CID 131735817
[6-amino-5-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-3-pyridinyl]boronic acid (PubChem CID 131735817) has the molecular formula C19H18BFN4O3 and a molecular weight of 380.19 g/mol. Its IUPAC name is [6-amino-5-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-3-pyridinyl]boronic acid.
| Compound Name | [6-amino-5-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 131735817 |
| Molecular Formula | C19H18BFN4O3 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [6-amino-5-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-3-pyridinyl]boronic acid |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cc(B(O)O)cnc3N)cc2)c1 |
| InChI | InChI=1S/C19H18BFN4O3/c1-11-2-7-16(21)17(8-11)25-19(26)24-14-5-3-12(4-6-14)15-9-13(20(27)28)10-23-18(15)22/h2-10,27-28H,1H3,(H2,22,23)(H2,24,25,26) |
| InChIKey | HENUTJSTZJVGEK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|