C23H22FN5O3 — CID 11166445
1-[4-[3-amino-7-(methoxymethoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea (PubChem CID 11166445) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is 1-[4-[3-amino-7-(methoxymethoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea.
| Compound Name | 1-[4-[3-amino-7-(methoxymethoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 11166445 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-[4-[3-amino-7-(methoxymethoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
| SMILES | COCOc1ccc(-c2ccc(NC(=O)Nc3cc(C)ccc3F)cc2)c2c(N)n[nH]c12 |
| InChI | InChI=1S/C23H22FN5O3/c1-13-3-9-17(24)18(11-13)27-23(30)26-15-6-4-14(5-7-15)16-8-10-19(32-12-31-2)21-20(16)22(25)29-28-21/h3-11H,12H2,1-2H3,(H3,25,28,29)(H2,26,27,30) |
| InChIKey | BTZZJDQGJIKMSR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|