C29H27FN6O2 — CID 66680959
1-[4-[3-amino-7-(3-pyridin-4-ylpropoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea (PubChem CID 66680959) has the molecular formula C29H27FN6O2 and a molecular weight of 510.57 g/mol. Its IUPAC name is 1-[4-[3-amino-7-(3-pyridin-4-ylpropoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea.
| Compound Name | 1-[4-[3-amino-7-(3-pyridin-4-ylpropoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 66680959 |
| Molecular Formula | C29H27FN6O2 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 1-[4-[3-amino-7-(3-pyridin-4-ylpropoxy)-1H-indazol-4-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3ccc(OCCCc4ccncc4)c4[nH]nc(N)c34)cc2)c1 |
| InChI | InChI=1S/C29H27FN6O2/c1-18-4-10-23(30)24(17-18)34-29(37)33-21-7-5-20(6-8-21)22-9-11-25(27-26(22)28(31)36-35-27)38-16-2-3-19-12-14-32-15-13-19/h4-15,17H,2-3,16H2,1H3,(H3,31,35,36)(H2,33,34,37) |
| InChIKey | QAFQPWYVEAVION-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|