C28H24ClN5O2 — CID 66681736
1-[4-[3-amino-7-[(4-chlorophenoxy)methyl]-1H-indazol-4-yl]phenyl]-3-(3-methylphenyl)urea (PubChem CID 66681736) has the molecular formula C28H24ClN5O2 and a molecular weight of 497.99 g/mol. Its IUPAC name is 1-[4-[3-amino-7-[(4-chlorophenoxy)methyl]-1H-indazol-4-yl]phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-[3-amino-7-[(4-chlorophenoxy)methyl]-1H-indazol-4-yl]phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 66681736 |
| Molecular Formula | C28H24ClN5O2 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 1-[4-[3-amino-7-[(4-chlorophenoxy)methyl]-1H-indazol-4-yl]phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3ccc(COc4ccc(Cl)cc4)c4[nH]nc(N)c34)cc2)c1 |
| InChI | InChI=1S/C28H24ClN5O2/c1-17-3-2-4-22(15-17)32-28(35)31-21-10-5-18(6-11-21)24-14-7-19(26-25(24)27(30)34-33-26)16-36-23-12-8-20(29)9-13-23/h2-15H,16H2,1H3,(H3,30,33,34)(H2,31,32,35) |
| InChIKey | AZRIYEQYTKAJJM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |