C24H25BrN6O2 — CID 66682276
1-[4-[3-amino-7-[2-(dimethylamino)ethoxy]-1H-indazol-4-yl]phenyl]-3-(3-bromophenyl)urea (PubChem CID 66682276) has the molecular formula C24H25BrN6O2 and a molecular weight of 509.41 g/mol. Its IUPAC name is 1-[4-[3-amino-7-[2-(dimethylamino)ethoxy]-1H-indazol-4-yl]phenyl]-3-(3-bromophenyl)urea.
| Compound Name | 1-[4-[3-amino-7-[2-(dimethylamino)ethoxy]-1H-indazol-4-yl]phenyl]-3-(3-bromophenyl)urea |
|---|---|
| PubChem CID | 66682276 |
| Molecular Formula | C24H25BrN6O2 |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 1-[4-[3-amino-7-[2-(dimethylamino)ethoxy]-1H-indazol-4-yl]phenyl]-3-(3-bromophenyl)urea |
| SMILES | CN(C)CCOc1ccc(-c2ccc(NC(=O)Nc3cccc(Br)c3)cc2)c2c(N)n[nH]c12 |
| InChI | InChI=1S/C24H25BrN6O2/c1-31(2)12-13-33-20-11-10-19(21-22(20)29-30-23(21)26)15-6-8-17(9-7-15)27-24(32)28-18-5-3-4-16(25)14-18/h3-11,14H,12-13H2,1-2H3,(H3,26,29,30)(H2,27,28,32) |
| InChIKey | ROQKGGMKPQGCPR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |