C24H25ClN6O — CID 66680336
1-[4-[3-amino-1-[2-(dimethylamino)ethyl]indazol-4-yl]phenyl]-3-(3-chlorophenyl)urea (PubChem CID 66680336) has the molecular formula C24H25ClN6O and a molecular weight of 448.96 g/mol. Its IUPAC name is 1-[4-[3-amino-1-[2-(dimethylamino)ethyl]indazol-4-yl]phenyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[4-[3-amino-1-[2-(dimethylamino)ethyl]indazol-4-yl]phenyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 66680336 |
| Molecular Formula | C24H25ClN6O |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-[4-[3-amino-1-[2-(dimethylamino)ethyl]indazol-4-yl]phenyl]-3-(3-chlorophenyl)urea |
| SMILES | CN(C)CCn1nc(N)c2c(-c3ccc(NC(=O)Nc4cccc(Cl)c4)cc3)cccc21 |
| InChI | InChI=1S/C24H25ClN6O/c1-30(2)13-14-31-21-8-4-7-20(22(21)23(26)29-31)16-9-11-18(12-10-16)27-24(32)28-19-6-3-5-17(25)15-19/h3-12,15H,13-14H2,1-2H3,(H2,26,29)(H2,27,28,32) |
| InChIKey | GSNARJQFXCOUTN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |