C20H15ClN4OS — CID 66681363
1-[4-(3-amino-1,2-benzothiazol-4-yl)phenyl]-3-(3-chlorophenyl)urea (PubChem CID 66681363) has the molecular formula C20H15ClN4OS and a molecular weight of 394.89 g/mol. Its IUPAC name is 1-[4-(3-amino-1,2-benzothiazol-4-yl)phenyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[4-(3-amino-1,2-benzothiazol-4-yl)phenyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 66681363 |
| Molecular Formula | C20H15ClN4OS |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[4-(3-amino-1,2-benzothiazol-4-yl)phenyl]-3-(3-chlorophenyl)urea |
| SMILES | Nc1nsc2cccc(-c3ccc(NC(=O)Nc4cccc(Cl)c4)cc3)c12 |
| InChI | InChI=1S/C20H15ClN4OS/c21-13-3-1-4-15(11-13)24-20(26)23-14-9-7-12(8-10-14)16-5-2-6-17-18(16)19(22)25-27-17/h1-11H,(H2,22,25)(H2,23,24,26) |
| InChIKey | REEWPWMKHZPSHV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |