C22H21N5O2 — CID 11463344
1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-[4-(dimethylamino)phenyl]urea (PubChem CID 11463344) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 11463344 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-[4-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccc(-c3cccc4onc(N)c34)cc2)cc1 |
| InChI | InChI=1S/C22H21N5O2/c1-27(2)17-12-10-16(11-13-17)25-22(28)24-15-8-6-14(7-9-15)18-4-3-5-19-20(18)21(23)26-29-19/h3-13H,1-2H3,(H2,23,26)(H2,24,25,28) |
| InChIKey | JPOGTBHBEQUQSB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|