C13H11N3O — CID 24768394
4-(4-aminophenyl)-1,2-benzoxazol-3-amine (PubChem CID 24768394) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-(4-aminophenyl)-1,2-benzoxazol-3-amine.
| Compound Name | 4-(4-aminophenyl)-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 24768394 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-(4-aminophenyl)-1,2-benzoxazol-3-amine |
| SMILES | Nc1ccc(-c2cccc3onc(N)c23)cc1 |
| InChI | InChI=1S/C13H11N3O/c14-9-6-4-8(5-7-9)10-2-1-3-11-12(10)13(15)16-17-11/h1-7H,14H2,(H2,15,16) |
| InChIKey | RBVHBTLBKSWXCF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|