C14H12N2O2 — CID 110282084
4-phenylmethoxy-1,2-benzoxazol-3-amine (PubChem CID 110282084) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-phenylmethoxy-1,2-benzoxazol-3-amine.
| Compound Name | 4-phenylmethoxy-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 110282084 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4-phenylmethoxy-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C14H12N2O2/c15-14-13-11(7-4-8-12(13)18-16-14)17-9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,15,16) |
| InChIKey | QAKSEPTVKXBHOB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |