C28H28N4O3S — CID 45140069
tert-butyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate (PubChem CID 45140069) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 45140069 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | tert-butyl (E)-3-[4-amino-3-[4-[(3-methylphenyl)carbamoylamino]phenyl]thieno[3,2-c]pyridin-7-yl]prop-2-enoate |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3csc4c(/C=C/C(=O)OC(C)(C)C)cnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C28H28N4O3S/c1-17-6-5-7-21(14-17)32-27(34)31-20-11-8-18(9-12-20)22-16-36-25-19(15-30-26(29)24(22)25)10-13-23(33)35-28(2,3)4/h5-16H,1-4H3,(H2,29,30)(H2,31,32,34)/b13-10+ |
| InChIKey | MZMZXZAQTWIIOO-JLHYYAGUSA-N |
| XLogP | 6.85 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|