C27H23N5O2S — CID 122188517
N-[2-[4-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]pyrazol-1-yl]ethyl]prop-2-enamide (PubChem CID 122188517) has the molecular formula C27H23N5O2S and a molecular weight of 481.58 g/mol. Its IUPAC name is N-[2-[4-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]pyrazol-1-yl]ethyl]prop-2-enamide.
| Compound Name | N-[2-[4-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]pyrazol-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122188517 |
| Molecular Formula | C27H23N5O2S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[2-[4-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]pyrazol-1-yl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCn1cc(-c2cnc(N)c3c(-c4ccc(Oc5ccccc5)cc4)csc23)cn1 |
| InChI | InChI=1S/C27H23N5O2S/c1-2-24(33)29-12-13-32-16-19(14-31-32)22-15-30-27(28)25-23(17-35-26(22)25)18-8-10-21(11-9-18)34-20-6-4-3-5-7-20/h2-11,14-17H,1,12-13H2,(H2,28,30)(H,29,33) |
| InChIKey | RKIFAARLAPFAHQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|