C31H32N4O4S — CID 68679171
tert-butyl 3-[3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enoylamino]pyrrolidine-1-carboxylate (PubChem CID 68679171) has the molecular formula C31H32N4O4S and a molecular weight of 556.69 g/mol. Its IUPAC name is tert-butyl 3-[3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enoylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enoylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68679171 |
| Molecular Formula | C31H32N4O4S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | tert-butyl 3-[3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enoylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C=Cc2cnc(N)c3c(-c4ccc(Oc5ccccc5)cc4)csc23)C1 |
| InChI | InChI=1S/C31H32N4O4S/c1-31(2,3)39-30(37)35-16-15-22(18-35)34-26(36)14-11-21-17-33-29(32)27-25(19-40-28(21)27)20-9-12-24(13-10-20)38-23-7-5-4-6-8-23/h4-14,17,19,22H,15-16,18H2,1-3H3,(H2,32,33)(H,34,36) |
| InChIKey | ABMFYXUUGDSKFV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|