C26H24N4O2S — CID 68680347
3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]-N-[(3S)-pyrrolidin-3-yl]prop-2-enamide (PubChem CID 68680347) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is 3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]-N-[(3S)-pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | 3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]-N-[(3S)-pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 68680347 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[4-amino-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-7-yl]-N-[(3S)-pyrrolidin-3-yl]prop-2-enamide |
| SMILES | Nc1ncc(C=CC(=O)N[C@H]2CCNC2)c2scc(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C26H24N4O2S/c27-26-24-22(17-6-9-21(10-7-17)32-20-4-2-1-3-5-20)16-33-25(24)18(14-29-26)8-11-23(31)30-19-12-13-28-15-19/h1-11,14,16,19,28H,12-13,15H2,(H2,27,29)(H,30,31)/t19-/m0/s1 |
| InChIKey | BCZJFIJMENPXIC-IBGZPJMESA-N |
| XLogP | 4.83 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|