C17H15N3OS — CID 18450643
(E)-3-(4-amino-3-phenylthieno[3,2-c]pyridin-7-yl)-N-methylprop-2-enamide (PubChem CID 18450643) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is (E)-3-(4-amino-3-phenylthieno[3,2-c]pyridin-7-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-(4-amino-3-phenylthieno[3,2-c]pyridin-7-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 18450643 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (E)-3-(4-amino-3-phenylthieno[3,2-c]pyridin-7-yl)-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1cnc(N)c2c(-c3ccccc3)csc12 |
| InChI | InChI=1S/C17H15N3OS/c1-19-14(21)8-7-12-9-20-17(18)15-13(10-22-16(12)15)11-5-3-2-4-6-11/h2-10H,1H3,(H2,18,20)(H,19,21)/b8-7+ |
| InChIKey | LZZYPVDOPDMUEO-BQYQJAHWSA-N |
| XLogP | 3.30 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|