C16H17FN2O3S — CID 71864929
1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea (PubChem CID 71864929) has the molecular formula C16H17FN2O3S and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea.
| Compound Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 71864929 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[(3-hydroxythiolan-3-yl)methyl]urea |
| SMILES | O=C(NCC1(O)CCSC1)Nc1cc(-c2ccco2)ccc1F |
| InChI | InChI=1S/C16H17FN2O3S/c17-12-4-3-11(14-2-1-6-22-14)8-13(12)19-15(20)18-9-16(21)5-7-23-10-16/h1-4,6,8,21H,5,7,9-10H2,(H2,18,19,20) |
| InChIKey | XIPMIFBMZCYDMG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |