C18H23FN2O3 — CID 111475552
1-[2-fluoro-5-(furan-2-yl)phenyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 111475552) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea.
| Compound Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111475552 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | CC(C)(CO)CCCNC(=O)Nc1cc(-c2ccco2)ccc1F |
| InChI | InChI=1S/C18H23FN2O3/c1-18(2,12-22)8-4-9-20-17(23)21-15-11-13(6-7-14(15)19)16-5-3-10-24-16/h3,5-7,10-11,22H,4,8-9,12H2,1-2H3,(H2,20,21,23) |
| InChIKey | ZAOJTRKBMSOHKA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|