C14H20Cl2N2O2 — CID 111472690
1-(2,5-dichlorophenyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 111472690) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111472690 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | CC(C)(CO)CCCNC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-14(2,9-19)6-3-7-17-13(20)18-12-8-10(15)4-5-11(12)16/h4-5,8,19H,3,6-7,9H2,1-2H3,(H2,17,18,20) |
| InChIKey | PSVUQLDSMNEMGE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|