C16H22Cl2N2O2 — CID 108966461
N-(2,5-dichlorophenyl)-2,2-dimethyl-N'-pentylpropanediamide (PubChem CID 108966461) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2,2-dimethyl-N'-pentylpropanediamide.
| Compound Name | N-(2,5-dichlorophenyl)-2,2-dimethyl-N'-pentylpropanediamide |
|---|---|
| PubChem CID | 108966461 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2,2-dimethyl-N'-pentylpropanediamide |
| SMILES | CCCCCNC(=O)C(C)(C)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H22Cl2N2O2/c1-4-5-6-9-19-14(21)16(2,3)15(22)20-13-10-11(17)7-8-12(13)18/h7-8,10H,4-6,9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | XGYXCZGWFBLOLY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|