C17H28N2O2 — CID 111472850
1-(5-hydroxy-4,4-dimethylpentyl)-3-(4-propan-2-ylphenyl)urea (PubChem CID 111472850) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 111472850 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)NCCCC(C)(C)CO)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-13(2)14-6-8-15(9-7-14)19-16(21)18-11-5-10-17(3,4)12-20/h6-9,13,20H,5,10-12H2,1-4H3,(H2,18,19,21) |
| InChIKey | LCLGOTPUCOGFQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|