C14H26N4O2 — CID 111618223
1-(5-hydroxy-4,4-dimethylpentyl)-3-(1-propan-2-ylpyrazol-4-yl)urea (PubChem CID 111618223) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-3-(1-propan-2-ylpyrazol-4-yl)urea.
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(1-propan-2-ylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 111618223 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-(1-propan-2-ylpyrazol-4-yl)urea |
| SMILES | CC(C)n1cc(NC(=O)NCCCC(C)(C)CO)cn1 |
| InChI | InChI=1S/C14H26N4O2/c1-11(2)18-9-12(8-16-18)17-13(20)15-7-5-6-14(3,4)10-19/h8-9,11,19H,5-7,10H2,1-4H3,(H2,15,17,20) |
| InChIKey | KPMCBRUGUIJBIA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|