C13H24N4O2 — CID 111505194
1-(5-hydroxy-4,4-dimethylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 111505194) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 111505194 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | Cn1cc(CNC(=O)NCCCC(C)(C)CO)cn1 |
| InChI | InChI=1S/C13H24N4O2/c1-13(2,10-18)5-4-6-14-12(19)15-7-11-8-16-17(3)9-11/h8-9,18H,4-7,10H2,1-3H3,(H2,14,15,19) |
| InChIKey | GGIQSBGMAAWLOX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|