C17H25N5O2 — CID 111505043
1-(5-hydroxy-4,4-dimethylpentyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]urea (PubChem CID 111505043) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]urea.
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 111505043 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]urea |
| SMILES | CC(C)(CO)CCCNC(=O)NCc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C17H25N5O2/c1-17(2,11-23)8-3-9-19-16(24)20-10-14-4-6-15(7-5-14)22-13-18-12-21-22/h4-7,12-13,23H,3,8-11H2,1-2H3,(H2,19,20,24) |
| InChIKey | YPLAVYSURVQOEK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|