C12H22N4O2 — CID 111505196
1-(3-hydroxy-4-methylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 111505196) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3-hydroxy-4-methylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-(3-hydroxy-4-methylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 111505196 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-(3-hydroxy-4-methylpentyl)-3-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | CC(C)C(O)CCNC(=O)NCc1cnn(C)c1 |
| InChI | InChI=1S/C12H22N4O2/c1-9(2)11(17)4-5-13-12(18)14-6-10-7-15-16(3)8-10/h7-9,11,17H,4-6H2,1-3H3,(H2,13,14,18) |
| InChIKey | IKLNPBXNOIIKTJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |