C17H25FN2O3 — CID 111439190
N'-(2-fluoro-4-methylphenyl)-N-(2-hydroxy-2-propylpentyl)oxamide (PubChem CID 111439190) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is N'-(2-fluoro-4-methylphenyl)-N-(2-hydroxy-2-propylpentyl)oxamide.
| Compound Name | N'-(2-fluoro-4-methylphenyl)-N-(2-hydroxy-2-propylpentyl)oxamide |
|---|---|
| PubChem CID | 111439190 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N'-(2-fluoro-4-methylphenyl)-N-(2-hydroxy-2-propylpentyl)oxamide |
| SMILES | CCCC(O)(CCC)CNC(=O)C(=O)Nc1ccc(C)cc1F |
| InChI | InChI=1S/C17H25FN2O3/c1-4-8-17(23,9-5-2)11-19-15(21)16(22)20-14-7-6-12(3)10-13(14)18/h6-7,10,23H,4-5,8-9,11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | ZJJWUCZOAVBFAB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|