C13H20FN3O — CID 106141258
1-(4-amino-2,2-dimethylbutyl)-3-(2-fluorophenyl)urea (PubChem CID 106141258) has the molecular formula C13H20FN3O and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-(4-amino-2,2-dimethylbutyl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(4-amino-2,2-dimethylbutyl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 106141258 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-(4-amino-2,2-dimethylbutyl)-3-(2-fluorophenyl)urea |
| SMILES | CC(C)(CCN)CNC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C13H20FN3O/c1-13(2,7-8-15)9-16-12(18)17-11-6-4-3-5-10(11)14/h3-6H,7-9,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | FZUCTRPRMQKSDH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |