C12H16FN3O2 — CID 17269898
1-(2,2-dimethylpropanoylamino)-3-(2-fluorophenyl)urea (PubChem CID 17269898) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoylamino)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(2,2-dimethylpropanoylamino)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 17269898 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-(2,2-dimethylpropanoylamino)-3-(2-fluorophenyl)urea |
| SMILES | CC(C)(C)C(=O)NNC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H16FN3O2/c1-12(2,3)10(17)15-16-11(18)14-9-7-5-4-6-8(9)13/h4-7H,1-3H3,(H,15,17)(H2,14,16,18) |
| InChIKey | OJHMTEYZNNSSJD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|