C12H16FN3O — CID 131990795
1-[(E)-2,2-dimethylpropylideneamino]-3-(2-fluorophenyl)urea (PubChem CID 131990795) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-[(E)-2,2-dimethylpropylideneamino]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(E)-2,2-dimethylpropylideneamino]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 131990795 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-[(E)-2,2-dimethylpropylideneamino]-3-(2-fluorophenyl)urea |
| SMILES | CC(C)(C)/C=N/NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H16FN3O/c1-12(2,3)8-14-16-11(17)15-10-7-5-4-6-9(10)13/h4-8H,1-3H3,(H2,15,16,17)/b14-8+ |
| InChIKey | ILSYFSQVPUZQGY-RIYZIHGNSA-N |
| XLogP | 2.98 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|