C14H16FN3O2 — CID 17380662
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-fluorophenyl)urea (PubChem CID 17380662) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 17380662 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-fluorophenyl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccccc2F)no1 |
| InChI | InChI=1S/C14H16FN3O2/c1-14(2,3)11-8-12(18-20-11)17-13(19)16-10-7-5-4-6-9(10)15/h4-8H,1-3H3,(H2,16,17,18,19) |
| InChIKey | IQVJJEJCWFJAIT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |