C15H19N3O3 — CID 108812308
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-hydroxy-5-methylphenyl)urea (PubChem CID 108812308) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-hydroxy-5-methylphenyl)urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-hydroxy-5-methylphenyl)urea |
|---|---|
| PubChem CID | 108812308 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-hydroxy-5-methylphenyl)urea |
| SMILES | Cc1ccc(O)c(NC(=O)Nc2cc(C(C)(C)C)on2)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-9-5-6-11(19)10(7-9)16-14(20)17-13-8-12(21-18-13)15(2,3)4/h5-8,19H,1-4H3,(H2,16,17,18,20) |
| InChIKey | BQQPOVXFXBENNU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|