C23H27N3O4 — CID 54131951
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-hydroxy-4-(4-propan-2-yloxyphenyl)phenyl]urea (PubChem CID 54131951) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-hydroxy-4-(4-propan-2-yloxyphenyl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-hydroxy-4-(4-propan-2-yloxyphenyl)phenyl]urea |
|---|---|
| PubChem CID | 54131951 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-hydroxy-4-(4-propan-2-yloxyphenyl)phenyl]urea |
| SMILES | CC(C)Oc1ccc(-c2ccc(NC(=O)Nc3cc(C(C)(C)C)on3)c(O)c2)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-14(2)29-17-9-6-15(7-10-17)16-8-11-18(19(27)12-16)24-22(28)25-21-13-20(30-26-21)23(3,4)5/h6-14,27H,1-5H3,(H2,24,25,26,28) |
| InChIKey | NUZGROYQMMUWPX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|