C13H18F2N2O2 — CID 111430082
1-(2,4-difluorophenyl)-3-(1-hydroxy-2-methylpentan-2-yl)urea (PubChem CID 111430082) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(1-hydroxy-2-methylpentan-2-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(1-hydroxy-2-methylpentan-2-yl)urea |
|---|---|
| PubChem CID | 111430082 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(1-hydroxy-2-methylpentan-2-yl)urea |
| SMILES | CCCC(C)(CO)NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H18F2N2O2/c1-3-6-13(2,8-18)17-12(19)16-11-5-4-9(14)7-10(11)15/h4-5,7,18H,3,6,8H2,1-2H3,(H2,16,17,19) |
| InChIKey | VBPYSDLJUAPBKB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |