C13H21N3O3 — CID 111754914
1-(1-hydroxy-2-methylpentan-2-yl)-3-(1-methyl-2-oxo-3-pyridinyl)urea (PubChem CID 111754914) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpentan-2-yl)-3-(1-methyl-2-oxo-3-pyridinyl)urea.
| Compound Name | 1-(1-hydroxy-2-methylpentan-2-yl)-3-(1-methyl-2-oxo-3-pyridinyl)urea |
|---|---|
| PubChem CID | 111754914 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-(1-hydroxy-2-methylpentan-2-yl)-3-(1-methyl-2-oxo-3-pyridinyl)urea |
| SMILES | CCCC(C)(CO)NC(=O)Nc1cccn(C)c1=O |
| InChI | InChI=1S/C13H21N3O3/c1-4-7-13(2,9-17)15-12(19)14-10-6-5-8-16(3)11(10)18/h5-6,8,17H,4,7,9H2,1-3H3,(H2,14,15,19) |
| InChIKey | UVOCHDRHCASVEY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |