About 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate
2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate (PubChem CID 23202915) has the molecular formula C14H19N3O4
and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate |
| PubChem CID | 23202915 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate |
| SMILES | NC(=O)N(C(=O)OCCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C14H19N3O4/c15-13(18)17(12-4-2-1-3-5-12)14(19)21-11-8-16-6-9-20-10-7-16/h1-5H,6-11H2,(H2,15,18) |
| InChIKey | RNQNRWYNFMXZTA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate?
The IUPAC name of 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate (CID 23202915) is 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate.
What is the SMILES notation for 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate?
The canonical SMILES for 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate is NC(=O)N(C(=O)OCCN1CCOCC1)c1ccccc1.
What is the InChIKey of 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate?
The InChIKey is RNQNRWYNFMXZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O4/c15-13(18)17(12-4-2-1-3-5-12)14(19)21-11-8-16-6-9-20-10-7-16/h1-5H,6-11H2,(H2,15,18).
What are the key properties of 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate?
2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate has a molecular weight of 293.32 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl N-carbamoyl-N-phenylcarbamate is sourced from PubChem (CID 23202915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).