About 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate
2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate (PubChem CID 139677499) has the molecular formula C22H28N4O4
and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate.
Molecular Properties
| Compound Name | 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate |
| PubChem CID | 139677499 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate |
| SMILES | NC(=O)OCCN1CCN(CCOC(=O)N(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N4O4/c23-21(27)29-17-15-24-11-13-25(14-12-24)16-18-30-22(28)26(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10H,11-18H2,(H2,23,27) |
| InChIKey | WTDFSGDHWJLMGH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate?
The IUPAC name of 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate (CID 139677499) is 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate.
What is the SMILES notation for 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate?
The canonical SMILES for 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate is NC(=O)OCCN1CCN(CCOC(=O)N(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate?
The InChIKey is WTDFSGDHWJLMGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O4/c23-21(27)29-17-15-24-11-13-25(14-12-24)16-18-30-22(28)26(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10H,11-18H2,(H2,23,27).
What are the key properties of 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate?
2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate has a molecular weight of 412.49 g/mol, XLogP of 2.67, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-carbamoyloxyethyl)piperazin-1-yl]ethyl N,N-diphenylcarbamate is sourced from PubChem (CID 139677499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).