C13H17F2N3O2 — CID 175030898
2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl carbamate (PubChem CID 175030898) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl carbamate.
| Compound Name | 2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl carbamate |
|---|---|
| PubChem CID | 175030898 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl carbamate |
| SMILES | NC(=O)OCCN1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H17F2N3O2/c14-10-1-2-12(11(15)9-10)18-5-3-17(4-6-18)7-8-20-13(16)19/h1-2,9H,3-8H2,(H2,16,19) |
| InChIKey | HNKGUNKSDKSMTB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |