C17H18F2N2 — CID 110454865
1-benzyl-4-(2,4-difluorophenyl)piperazine (PubChem CID 110454865) has the molecular formula C17H18F2N2 and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-benzyl-4-(2,4-difluorophenyl)piperazine.
| Compound Name | 1-benzyl-4-(2,4-difluorophenyl)piperazine |
|---|---|
| PubChem CID | 110454865 |
| Molecular Formula | C17H18F2N2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-benzyl-4-(2,4-difluorophenyl)piperazine |
| SMILES | Fc1ccc(N2CCN(Cc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C17H18F2N2/c18-15-6-7-17(16(19)12-15)21-10-8-20(9-11-21)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | ULODCDKUHSMGJQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |