C22H23F2N3O2 — CID 113190652
4-(4-benzylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one (PubChem CID 113190652) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-(4-benzylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-(4-benzylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 113190652 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-(4-benzylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one |
| SMILES | O=C(C1CC(=O)N(c2ccc(F)cc2F)C1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23F2N3O2/c23-18-6-7-20(19(24)13-18)27-15-17(12-21(27)28)22(29)26-10-8-25(9-11-26)14-16-4-2-1-3-5-16/h1-7,13,17H,8-12,14-15H2 |
| InChIKey | IDRJPGPEXQVNHR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |