C17H20ClF2N3O2 — CID 120656440
4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-(2,4-difluorophenyl)pyrrolidin-2-one;hydrochloride (PubChem CID 120656440) has the molecular formula C17H20ClF2N3O2 and a molecular weight of 371.82 g/mol. Its IUPAC name is 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-(2,4-difluorophenyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-(2,4-difluorophenyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120656440 |
| Molecular Formula | C17H20ClF2N3O2 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-(2,4-difluorophenyl)pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.O=C(C1CC(=O)N(c2ccc(F)cc2F)C1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C17H19F2N3O2.ClH/c18-13-1-2-15(14(19)4-13)22-9-10(3-16(22)23)17(24)21-7-11-5-20-6-12(11)8-21;/h1-2,4,10-12,20H,3,5-9H2;1H/t10?,11-,12+; |
| InChIKey | LAGMXEWAWMHHJK-YSEZWWCESA-N |
| XLogP | 1.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |