C23H26FN3O2 — CID 113183434
4-(4-benzylpiperazine-1-carbonyl)-1-[(2-fluorophenyl)methyl]pyrrolidin-2-one (PubChem CID 113183434) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-(4-benzylpiperazine-1-carbonyl)-1-[(2-fluorophenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-(4-benzylpiperazine-1-carbonyl)-1-[(2-fluorophenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 113183434 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-(4-benzylpiperazine-1-carbonyl)-1-[(2-fluorophenyl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCN(Cc3ccccc3)CC2)CN1Cc1ccccc1F |
| InChI | InChI=1S/C23H26FN3O2/c24-21-9-5-4-8-19(21)16-27-17-20(14-22(27)28)23(29)26-12-10-25(11-13-26)15-18-6-2-1-3-7-18/h1-9,20H,10-17H2 |
| InChIKey | RIAHSTRPNLNJJK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |