C21H24FN3O3 — CID 43003170
4-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-1-(furan-2-ylmethyl)pyrrolidin-2-one (PubChem CID 43003170) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-1-(furan-2-ylmethyl)pyrrolidin-2-one.
| Compound Name | 4-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-1-(furan-2-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 43003170 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-1-(furan-2-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCN(Cc3ccccc3F)CC2)CN1Cc1ccco1 |
| InChI | InChI=1S/C21H24FN3O3/c22-19-6-2-1-4-16(19)13-23-7-9-24(10-8-23)21(27)17-12-20(26)25(14-17)15-18-5-3-11-28-18/h1-6,11,17H,7-10,12-15H2 |
| InChIKey | OOIYJRNRMXZBKG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |