C20H22FN5O2 — CID 113183445
1-[(2-fluorophenyl)methyl]-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 113183445) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-[(2-fluorophenyl)methyl]-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 113183445 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCN(c3ncccn3)CC2)CN1Cc1ccccc1F |
| InChI | InChI=1S/C20H22FN5O2/c21-17-5-2-1-4-15(17)13-26-14-16(12-18(26)27)19(28)24-8-10-25(11-9-24)20-22-6-3-7-23-20/h1-7,16H,8-14H2 |
| InChIKey | OPRMLTXCKQSQJP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |