C19H25N3O3 — CID 56807347
4-(4-acetyl-1,4-diazepane-1-carbonyl)-1-benzylpyrrolidin-2-one (PubChem CID 56807347) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-(4-acetyl-1,4-diazepane-1-carbonyl)-1-benzylpyrrolidin-2-one.
| Compound Name | 4-(4-acetyl-1,4-diazepane-1-carbonyl)-1-benzylpyrrolidin-2-one |
|---|---|
| PubChem CID | 56807347 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-(4-acetyl-1,4-diazepane-1-carbonyl)-1-benzylpyrrolidin-2-one |
| SMILES | CC(=O)N1CCCN(C(=O)C2CC(=O)N(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C19H25N3O3/c1-15(23)20-8-5-9-21(11-10-20)19(25)17-12-18(24)22(14-17)13-16-6-3-2-4-7-16/h2-4,6-7,17H,5,8-14H2,1H3 |
| InChIKey | ZZMPHITXWRZUQV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |